C12H14O2 — CID 105426415
[1-(2,3-dihydro-1-benzofuran-5-yl)cyclopropyl]methanol (PubChem CID 105426415) has the molecular formula C12H14O2 and a molecular weight of 190.24 g/mol. Its IUPAC name is [1-(2,3-dihydro-1-benzofuran-5-yl)cyclopropyl]methanol.
| Compound Name | [1-(2,3-dihydro-1-benzofuran-5-yl)cyclopropyl]methanol |
|---|---|
| PubChem CID | 105426415 |
| Molecular Formula | C12H14O2 |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.10 |
| IUPAC Name | [1-(2,3-dihydro-1-benzofuran-5-yl)cyclopropyl]methanol |
| SMILES | OCC1(c2ccc3c(c2)CCO3)CC1 |
| InChI | InChI=1S/C12H14O2/c13-8-12(4-5-12)10-1-2-11-9(7-10)3-6-14-11/h1-2,7,13H,3-6,8H2 |
| InChIKey | NCCLXDPVCRKKFX-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |