C14H18O3 — CID 106823465
1-(2,3-dihydro-1-benzofuran-5-yl)-3-ethoxycyclobutan-1-ol (PubChem CID 106823465) has the molecular formula C14H18O3 and a molecular weight of 234.29 g/mol. Its IUPAC name is 1-(2,3-dihydro-1-benzofuran-5-yl)-3-ethoxycyclobutan-1-ol.
| Compound Name | 1-(2,3-dihydro-1-benzofuran-5-yl)-3-ethoxycyclobutan-1-ol |
|---|---|
| PubChem CID | 106823465 |
| Molecular Formula | C14H18O3 |
| Molecular Weight | 234.29 g/mol |
| Exact Mass | 234.13 |
| IUPAC Name | 1-(2,3-dihydro-1-benzofuran-5-yl)-3-ethoxycyclobutan-1-ol |
| SMILES | CCOC1CC(O)(c2ccc3c(c2)CCO3)C1 |
| InChI | InChI=1S/C14H18O3/c1-2-16-12-8-14(15,9-12)11-3-4-13-10(7-11)5-6-17-13/h3-4,7,12,15H,2,5-6,8-9H2,1H3 |
| InChIKey | SHDAFBJCLLMZBK-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.29 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |