C8H7NO2 — CID 143738609
6-nitroso-2,3-dihydro-1-benzofuran (PubChem CID 143738609) has the molecular formula C8H7NO2 and a molecular weight of 149.15 g/mol. Its IUPAC name is 6-nitroso-2,3-dihydro-1-benzofuran.
| Compound Name | 6-nitroso-2,3-dihydro-1-benzofuran |
|---|---|
| PubChem CID | 143738609 |
| Molecular Formula | C8H7NO2 |
| Molecular Weight | 149.15 g/mol |
| Exact Mass | 149.05 |
| IUPAC Name | 6-nitroso-2,3-dihydro-1-benzofuran |
| SMILES | O=Nc1ccc2c(c1)OCC2 |
| InChI | InChI=1S/C8H7NO2/c10-9-7-2-1-6-3-4-11-8(6)5-7/h1-2,5H,3-4H2 |
| InChIKey | TUPYKXSWSSAVGD-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.15 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |