C9H11N3O — CID 82648102
2-(2,3-dihydro-1-benzofuran-5-yl)guanidine (PubChem CID 82648102) has the molecular formula C9H11N3O and a molecular weight of 177.21 g/mol. Its IUPAC name is 2-(2,3-dihydro-1-benzofuran-5-yl)guanidine.
| Compound Name | 2-(2,3-dihydro-1-benzofuran-5-yl)guanidine |
|---|---|
| PubChem CID | 82648102 |
| Molecular Formula | C9H11N3O |
| Molecular Weight | 177.21 g/mol |
| Exact Mass | 177.09 |
| IUPAC Name | 2-(2,3-dihydro-1-benzofuran-5-yl)guanidine |
| SMILES | NC(N)=Nc1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C9H11N3O/c10-9(11)12-7-1-2-8-6(5-7)3-4-13-8/h1-2,5H,3-4H2,(H4,10,11,12) |
| InChIKey | WBMITDQCYDDLIU-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.21 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|