C8H8O3S — CID 22069128
2,3-dihydro-1-benzofuran-5-sulfinic acid (PubChem CID 22069128) has the molecular formula C8H8O3S and a molecular weight of 184.22 g/mol. Its IUPAC name is 2,3-dihydro-1-benzofuran-5-sulfinic acid.
| Compound Name | 2,3-dihydro-1-benzofuran-5-sulfinic acid |
|---|---|
| PubChem CID | 22069128 |
| Molecular Formula | C8H8O3S |
| Molecular Weight | 184.22 g/mol |
| Exact Mass | 184.02 |
| IUPAC Name | 2,3-dihydro-1-benzofuran-5-sulfinic acid |
| SMILES | O=S(O)c1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C8H8O3S/c9-12(10)7-1-2-8-6(5-7)3-4-11-8/h1-2,5H,3-4H2,(H,9,10) |
| InChIKey | VPYWSCXWCVSJHC-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.22 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|