C9H10O2S — CID 22503835
2,3-dihydro-1H-indene-5-sulfinic acid (PubChem CID 22503835) has the molecular formula C9H10O2S and a molecular weight of 182.24 g/mol. Its IUPAC name is 2,3-dihydro-1H-indene-5-sulfinic acid.
| Compound Name | 2,3-dihydro-1H-indene-5-sulfinic acid |
|---|---|
| PubChem CID | 22503835 |
| Molecular Formula | C9H10O2S |
| Molecular Weight | 182.24 g/mol |
| Exact Mass | 182.04 |
| IUPAC Name | 2,3-dihydro-1H-indene-5-sulfinic acid |
| SMILES | O=S(O)c1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C9H10O2S/c10-12(11)9-5-4-7-2-1-3-8(7)6-9/h4-6H,1-3H2,(H,10,11) |
| InChIKey | RWHKVOXOPYFKNM-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.24 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|