C14H19NOS — CID 64723256
3-(2,3-dihydro-1H-inden-5-ylsulfinyl)cyclopentan-1-amine (PubChem CID 64723256) has the molecular formula C14H19NOS and a molecular weight of 249.38 g/mol. Its IUPAC name is 3-(2,3-dihydro-1H-inden-5-ylsulfinyl)cyclopentan-1-amine.
| Compound Name | 3-(2,3-dihydro-1H-inden-5-ylsulfinyl)cyclopentan-1-amine |
|---|---|
| PubChem CID | 64723256 |
| Molecular Formula | C14H19NOS |
| Molecular Weight | 249.38 g/mol |
| Exact Mass | 249.12 |
| IUPAC Name | 3-(2,3-dihydro-1H-inden-5-ylsulfinyl)cyclopentan-1-amine |
| SMILES | NC1CCC(S(=O)c2ccc3c(c2)CCC3)C1 |
| InChI | InChI=1S/C14H19NOS/c15-12-5-7-14(9-12)17(16)13-6-4-10-2-1-3-11(10)8-13/h4,6,8,12,14H,1-3,5,7,9,15H2 |
| InChIKey | IUSQQHLNMNFUBN-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.38 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |