C15H21NO2S — CID 55115124
4-(2,3-dihydro-1H-inden-5-ylsulfonyl)cyclohexan-1-amine (PubChem CID 55115124) has the molecular formula C15H21NO2S and a molecular weight of 279.40 g/mol. Its IUPAC name is 4-(2,3-dihydro-1H-inden-5-ylsulfonyl)cyclohexan-1-amine.
| Compound Name | 4-(2,3-dihydro-1H-inden-5-ylsulfonyl)cyclohexan-1-amine |
|---|---|
| PubChem CID | 55115124 |
| Molecular Formula | C15H21NO2S |
| Molecular Weight | 279.40 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | 4-(2,3-dihydro-1H-inden-5-ylsulfonyl)cyclohexan-1-amine |
| SMILES | NC1CCC(S(=O)(=O)c2ccc3c(c2)CCC3)CC1 |
| InChI | InChI=1S/C15H21NO2S/c16-13-5-8-14(9-6-13)19(17,18)15-7-4-11-2-1-3-12(11)10-15/h4,7,10,13-14H,1-3,5-6,8-9,16H2 |
| InChIKey | RJUDSUCVDSVFMQ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.40 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |