C14H16O3S — CID 64642187
2-(2,3-dihydro-1H-inden-5-ylsulfonyl)cyclopentan-1-one (PubChem CID 64642187) has the molecular formula C14H16O3S and a molecular weight of 264.35 g/mol. Its IUPAC name is 2-(2,3-dihydro-1H-inden-5-ylsulfonyl)cyclopentan-1-one.
| Compound Name | 2-(2,3-dihydro-1H-inden-5-ylsulfonyl)cyclopentan-1-one |
|---|---|
| PubChem CID | 64642187 |
| Molecular Formula | C14H16O3S |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.08 |
| IUPAC Name | 2-(2,3-dihydro-1H-inden-5-ylsulfonyl)cyclopentan-1-one |
| SMILES | O=C1CCCC1S(=O)(=O)c1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C14H16O3S/c15-13-5-2-6-14(13)18(16,17)12-8-7-10-3-1-4-11(10)9-12/h7-9,14H,1-6H2 |
| InChIKey | BJMUGHSJVJWHPF-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |