C16H20ClNO2S — CID 63762795
3-chloro-8-(2,3-dihydro-1H-inden-5-ylsulfonyl)-8-azabicyclo[3.2.1]octane (PubChem CID 63762795) has the molecular formula C16H20ClNO2S and a molecular weight of 325.86 g/mol. Its IUPAC name is 3-chloro-8-(2,3-dihydro-1H-inden-5-ylsulfonyl)-8-azabicyclo[3.2.1]octane.
| Compound Name | 3-chloro-8-(2,3-dihydro-1H-inden-5-ylsulfonyl)-8-azabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 63762795 |
| Molecular Formula | C16H20ClNO2S |
| Molecular Weight | 325.86 g/mol |
| Exact Mass | 325.09 |
| IUPAC Name | 3-chloro-8-(2,3-dihydro-1H-inden-5-ylsulfonyl)-8-azabicyclo[3.2.1]octane |
| SMILES | O=S(=O)(c1ccc2c(c1)CCC2)N1C2CCC1CC(Cl)C2 |
| InChI | InChI=1S/C16H20ClNO2S/c17-13-9-14-5-6-15(10-13)18(14)21(19,20)16-7-4-11-2-1-3-12(11)8-16/h4,7-8,13-15H,1-3,5-6,9-10H2 |
| InChIKey | CEIFIAFUMIRUDF-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.86 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|