C16H19NO5S — CID 167778733
(3aS,6aS)-4-(2,3-dihydro-1H-inden-5-ylsulfonyl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-5-carboxylic acid (PubChem CID 167778733) has the molecular formula C16H19NO5S and a molecular weight of 337.40 g/mol. Its IUPAC name is (3aS,6aS)-4-(2,3-dihydro-1H-inden-5-ylsulfonyl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-5-carboxylic acid.
| Compound Name | (3aS,6aS)-4-(2,3-dihydro-1H-inden-5-ylsulfonyl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-5-carboxylic acid |
|---|---|
| PubChem CID | 167778733 |
| Molecular Formula | C16H19NO5S |
| Molecular Weight | 337.40 g/mol |
| Exact Mass | 337.10 |
| IUPAC Name | (3aS,6aS)-4-(2,3-dihydro-1H-inden-5-ylsulfonyl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-5-carboxylic acid |
| SMILES | O=C(O)C1C[C@@H]2OCC[C@@H]2N1S(=O)(=O)c1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C16H19NO5S/c18-16(19)14-9-15-13(6-7-22-15)17(14)23(20,21)12-5-4-10-2-1-3-11(10)8-12/h4-5,8,13-15H,1-3,6-7,9H2,(H,18,19)/t13-,14?,15-/m0/s1 |
| InChIKey | WIDFCSUMSGGWGX-LWEDLAQUSA-N |
| XLogP | 1.18 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.40 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |