C16H22N2O2S — CID 120719704
9-(2,3-dihydro-1H-inden-5-ylsulfonyl)-3,9-diazabicyclo[4.2.1]nonane (PubChem CID 120719704) has the molecular formula C16H22N2O2S and a molecular weight of 306.43 g/mol. Its IUPAC name is 9-(2,3-dihydro-1H-inden-5-ylsulfonyl)-3,9-diazabicyclo[4.2.1]nonane.
| Compound Name | 9-(2,3-dihydro-1H-inden-5-ylsulfonyl)-3,9-diazabicyclo[4.2.1]nonane |
|---|---|
| PubChem CID | 120719704 |
| Molecular Formula | C16H22N2O2S |
| Molecular Weight | 306.43 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | 9-(2,3-dihydro-1H-inden-5-ylsulfonyl)-3,9-diazabicyclo[4.2.1]nonane |
| SMILES | O=S(=O)(c1ccc2c(c1)CCC2)N1C2CCNCC1CC2 |
| InChI | InChI=1S/C16H22N2O2S/c19-21(20,16-7-4-12-2-1-3-13(12)10-16)18-14-5-6-15(18)11-17-9-8-14/h4,7,10,14-15,17H,1-3,5-6,8-9,11H2 |
| InChIKey | FBTBRTWVXFLTMD-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.43 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |