C18H22N4O2S — CID 163336127
(1R,9S)-12-(2,3-dihydro-1H-inden-5-ylsulfonyl)-4-methyl-3,5,6,12-tetrazatricyclo[7.2.1.03,7]dodeca-4,6-diene (PubChem CID 163336127) has the molecular formula C18H22N4O2S and a molecular weight of 358.47 g/mol. Its IUPAC name is (1R,9S)-12-(2,3-dihydro-1H-inden-5-ylsulfonyl)-4-methyl-3,5,6,12-tetrazatricyclo[7.2.1.03,7]dodeca-4,6-diene.
| Compound Name | (1R,9S)-12-(2,3-dihydro-1H-inden-5-ylsulfonyl)-4-methyl-3,5,6,12-tetrazatricyclo[7.2.1.03,7]dodeca-4,6-diene |
|---|---|
| PubChem CID | 163336127 |
| Molecular Formula | C18H22N4O2S |
| Molecular Weight | 358.47 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | (1R,9S)-12-(2,3-dihydro-1H-inden-5-ylsulfonyl)-4-methyl-3,5,6,12-tetrazatricyclo[7.2.1.03,7]dodeca-4,6-diene |
| SMILES | Cc1nnc2n1C[C@H]1CC[C@@H](C2)N1S(=O)(=O)c1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C18H22N4O2S/c1-12-19-20-18-10-15-6-7-16(11-21(12)18)22(15)25(23,24)17-8-5-13-3-2-4-14(13)9-17/h5,8-9,15-16H,2-4,6-7,10-11H2,1H3/t15-,16+/m0/s1 |
| InChIKey | AHDSIMHOTDACIV-JKSUJKDBSA-N |
| XLogP | 1.85 |
| TPSA | 68.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.47 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |