C16H19FN4O2S — CID 163337135
(1R,9S)-12-(4-fluoro-3-methylphenyl)sulfonyl-4-methyl-3,5,6,12-tetrazatricyclo[7.2.1.03,7]dodeca-4,6-diene (PubChem CID 163337135) has the molecular formula C16H19FN4O2S and a molecular weight of 350.42 g/mol. Its IUPAC name is (1R,9S)-12-(4-fluoro-3-methylphenyl)sulfonyl-4-methyl-3,5,6,12-tetrazatricyclo[7.2.1.03,7]dodeca-4,6-diene.
| Compound Name | (1R,9S)-12-(4-fluoro-3-methylphenyl)sulfonyl-4-methyl-3,5,6,12-tetrazatricyclo[7.2.1.03,7]dodeca-4,6-diene |
|---|---|
| PubChem CID | 163337135 |
| Molecular Formula | C16H19FN4O2S |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | (1R,9S)-12-(4-fluoro-3-methylphenyl)sulfonyl-4-methyl-3,5,6,12-tetrazatricyclo[7.2.1.03,7]dodeca-4,6-diene |
| SMILES | Cc1cc(S(=O)(=O)N2[C@@H]3CC[C@H]2Cc2nnc(C)n2C3)ccc1F |
| InChI | InChI=1S/C16H19FN4O2S/c1-10-7-14(5-6-15(10)17)24(22,23)21-12-3-4-13(21)9-20-11(2)18-19-16(20)8-12/h5-7,12-13H,3-4,8-9H2,1-2H3/t12-,13+/m0/s1 |
| InChIKey | RENALFVBLLBMIK-QWHCGFSZSA-N |
| XLogP | 1.81 |
| TPSA | 68.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |