C16H19FN4O2S — CID 121178380
8-(4-fluoro-3-methylphenyl)sulfonyl-3-(triazol-2-yl)-8-azabicyclo[3.2.1]octane (PubChem CID 121178380) has the molecular formula C16H19FN4O2S and a molecular weight of 350.42 g/mol. Its IUPAC name is 8-(4-fluoro-3-methylphenyl)sulfonyl-3-(triazol-2-yl)-8-azabicyclo[3.2.1]octane.
| Compound Name | 8-(4-fluoro-3-methylphenyl)sulfonyl-3-(triazol-2-yl)-8-azabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 121178380 |
| Molecular Formula | C16H19FN4O2S |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | 8-(4-fluoro-3-methylphenyl)sulfonyl-3-(triazol-2-yl)-8-azabicyclo[3.2.1]octane |
| SMILES | Cc1cc(S(=O)(=O)N2C3CCC2CC(n2nccn2)C3)ccc1F |
| InChI | InChI=1S/C16H19FN4O2S/c1-11-8-15(4-5-16(11)17)24(22,23)20-12-2-3-13(20)10-14(9-12)21-18-6-7-19-21/h4-8,12-14H,2-3,9-10H2,1H3 |
| InChIKey | SOIGINPHPRRSHR-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 68.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |