About 8-(2,5-difluorophenyl)sulfonyl-3-(triazol-2-yl)-8-azabicyclo[3.2.1]octane
8-(2,5-difluorophenyl)sulfonyl-3-(triazol-2-yl)-8-azabicyclo[3.2.1]octane (PubChem CID 121178385) has the molecular formula C15H16F2N4O2S
and a molecular weight of 354.38 g/mol. Its IUPAC name is 8-(2,5-difluorophenyl)sulfonyl-3-(triazol-2-yl)-8-azabicyclo[3.2.1]octane.
Molecular Properties
| Compound Name | 8-(2,5-difluorophenyl)sulfonyl-3-(triazol-2-yl)-8-azabicyclo[3.2.1]octane |
| PubChem CID | 121178385 |
| Molecular Formula | C15H16F2N4O2S |
| Molecular Weight | 354.38 g/mol |
| Exact Mass | 354.10 |
| IUPAC Name | 8-(2,5-difluorophenyl)sulfonyl-3-(triazol-2-yl)-8-azabicyclo[3.2.1]octane |
| SMILES | O=S(=O)(c1cc(F)ccc1F)N1C2CCC1CC(n1nccn1)C2 |
| InChI | InChI=1S/C15H16F2N4O2S/c16-10-1-4-14(17)15(7-10)24(22,23)20-11-2-3-12(20)9-13(8-11)21-18-5-6-19-21/h1,4-7,11-13H,2-3,8-9H2 |
| InChIKey | SAEPSFSWYJNPAT-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 68.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.38 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 8-(2,5-difluorophenyl)sulfonyl-3-(triazol-2-yl)-8-azabicyclo[3.2.1]octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(2,5-difluorophenyl)sulfonyl-3-(triazol-2-yl)-8-azabicyclo[3.2.1]octane?
The IUPAC name of 8-(2,5-difluorophenyl)sulfonyl-3-(triazol-2-yl)-8-azabicyclo[3.2.1]octane (CID 121178385) is 8-(2,5-difluorophenyl)sulfonyl-3-(triazol-2-yl)-8-azabicyclo[3.2.1]octane.
What is the SMILES notation for 8-(2,5-difluorophenyl)sulfonyl-3-(triazol-2-yl)-8-azabicyclo[3.2.1]octane?
The canonical SMILES for 8-(2,5-difluorophenyl)sulfonyl-3-(triazol-2-yl)-8-azabicyclo[3.2.1]octane is O=S(=O)(c1cc(F)ccc1F)N1C2CCC1CC(n1nccn1)C2.
What is the InChIKey of 8-(2,5-difluorophenyl)sulfonyl-3-(triazol-2-yl)-8-azabicyclo[3.2.1]octane?
The InChIKey is SAEPSFSWYJNPAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16F2N4O2S/c16-10-1-4-14(17)15(7-10)24(22,23)20-11-2-3-12(20)9-13(8-11)21-18-5-6-19-21/h1,4-7,11-13H,2-3,8-9H2.
What are the key properties of 8-(2,5-difluorophenyl)sulfonyl-3-(triazol-2-yl)-8-azabicyclo[3.2.1]octane?
8-(2,5-difluorophenyl)sulfonyl-3-(triazol-2-yl)-8-azabicyclo[3.2.1]octane has a molecular weight of 354.38 g/mol, XLogP of 2.11, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(2,5-difluorophenyl)sulfonyl-3-(triazol-2-yl)-8-azabicyclo[3.2.1]octane is sourced from PubChem (CID 121178385), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).