C19H19F2NO4S2 — CID 90591601
3-(benzenesulfonyl)-8-(2,5-difluorophenyl)sulfonyl-8-azabicyclo[3.2.1]octane (PubChem CID 90591601) has the molecular formula C19H19F2NO4S2 and a molecular weight of 427.49 g/mol. Its IUPAC name is 3-(benzenesulfonyl)-8-(2,5-difluorophenyl)sulfonyl-8-azabicyclo[3.2.1]octane.
| Compound Name | 3-(benzenesulfonyl)-8-(2,5-difluorophenyl)sulfonyl-8-azabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 90591601 |
| Molecular Formula | C19H19F2NO4S2 |
| Molecular Weight | 427.49 g/mol |
| Exact Mass | 427.07 |
| IUPAC Name | 3-(benzenesulfonyl)-8-(2,5-difluorophenyl)sulfonyl-8-azabicyclo[3.2.1]octane |
| SMILES | O=S(=O)(c1ccccc1)C1CC2CCC(C1)N2S(=O)(=O)c1cc(F)ccc1F |
| InChI | InChI=1S/C19H19F2NO4S2/c20-13-6-9-18(21)19(10-13)28(25,26)22-14-7-8-15(22)12-17(11-14)27(23,24)16-4-2-1-3-5-16/h1-6,9-10,14-15,17H,7-8,11-12H2 |
| InChIKey | IBIVVUCSXLUWQJ-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.49 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |