C19H20ClNO4S2 — CID 90591648
3-(benzenesulfonyl)-8-(4-chlorophenyl)sulfonyl-8-azabicyclo[3.2.1]octane (PubChem CID 90591648) has the molecular formula C19H20ClNO4S2 and a molecular weight of 425.96 g/mol. Its IUPAC name is 3-(benzenesulfonyl)-8-(4-chlorophenyl)sulfonyl-8-azabicyclo[3.2.1]octane.
| Compound Name | 3-(benzenesulfonyl)-8-(4-chlorophenyl)sulfonyl-8-azabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 90591648 |
| Molecular Formula | C19H20ClNO4S2 |
| Molecular Weight | 425.96 g/mol |
| Exact Mass | 425.05 |
| IUPAC Name | 3-(benzenesulfonyl)-8-(4-chlorophenyl)sulfonyl-8-azabicyclo[3.2.1]octane |
| SMILES | O=S(=O)(c1ccccc1)C1CC2CCC(C1)N2S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H20ClNO4S2/c20-14-6-10-18(11-7-14)27(24,25)21-15-8-9-16(21)13-19(12-15)26(22,23)17-4-2-1-3-5-17/h1-7,10-11,15-16,19H,8-9,12-13H2 |
| InChIKey | NQIBOQJJJZMDDH-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.96 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |