C14H19NO4S2 — CID 97417329
(1S,5R)-3-(benzenesulfonyl)-8-methylsulfonyl-8-azabicyclo[3.2.1]octane (PubChem CID 97417329) has the molecular formula C14H19NO4S2 and a molecular weight of 329.44 g/mol. Its IUPAC name is (1S,5R)-3-(benzenesulfonyl)-8-methylsulfonyl-8-azabicyclo[3.2.1]octane.
| Compound Name | (1S,5R)-3-(benzenesulfonyl)-8-methylsulfonyl-8-azabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 97417329 |
| Molecular Formula | C14H19NO4S2 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.08 |
| IUPAC Name | (1S,5R)-3-(benzenesulfonyl)-8-methylsulfonyl-8-azabicyclo[3.2.1]octane |
| SMILES | CS(=O)(=O)N1[C@@H]2CC[C@H]1CC(S(=O)(=O)c1ccccc1)C2 |
| InChI | InChI=1S/C14H19NO4S2/c1-20(16,17)15-11-7-8-12(15)10-14(9-11)21(18,19)13-5-3-2-4-6-13/h2-6,11-12,14H,7-10H2,1H3/t11-,12+,14? |
| InChIKey | YEOIPIZLLWQEBS-ONXXMXGDSA-N |
| XLogP | 1.42 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |