C21H23NO6S2 — CID 71808995
methyl 4-[[3-(benzenesulfonyl)-8-azabicyclo[3.2.1]octan-8-yl]sulfonyl]benzoate (PubChem CID 71808995) has the molecular formula C21H23NO6S2 and a molecular weight of 449.55 g/mol. Its IUPAC name is methyl 4-[[3-(benzenesulfonyl)-8-azabicyclo[3.2.1]octan-8-yl]sulfonyl]benzoate.
| Compound Name | methyl 4-[[3-(benzenesulfonyl)-8-azabicyclo[3.2.1]octan-8-yl]sulfonyl]benzoate |
|---|---|
| PubChem CID | 71808995 |
| Molecular Formula | C21H23NO6S2 |
| Molecular Weight | 449.55 g/mol |
| Exact Mass | 449.10 |
| IUPAC Name | methyl 4-[[3-(benzenesulfonyl)-8-azabicyclo[3.2.1]octan-8-yl]sulfonyl]benzoate |
| SMILES | COC(=O)c1ccc(S(=O)(=O)N2C3CCC2CC(S(=O)(=O)c2ccccc2)C3)cc1 |
| InChI | InChI=1S/C21H23NO6S2/c1-28-21(23)15-7-11-19(12-8-15)30(26,27)22-16-9-10-17(22)14-20(13-16)29(24,25)18-5-3-2-4-6-18/h2-8,11-12,16-17,20H,9-10,13-14H2,1H3 |
| InChIKey | VIBOSNAORSQBMS-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 97.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.55 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |