C21H23NO3S — CID 90591538
[3-(benzenesulfonyl)-8-azabicyclo[3.2.1]octan-8-yl]-(3-methylphenyl)methanone (PubChem CID 90591538) has the molecular formula C21H23NO3S and a molecular weight of 369.49 g/mol. Its IUPAC name is [3-(benzenesulfonyl)-8-azabicyclo[3.2.1]octan-8-yl]-(3-methylphenyl)methanone.
| Compound Name | [3-(benzenesulfonyl)-8-azabicyclo[3.2.1]octan-8-yl]-(3-methylphenyl)methanone |
|---|---|
| PubChem CID | 90591538 |
| Molecular Formula | C21H23NO3S |
| Molecular Weight | 369.49 g/mol |
| Exact Mass | 369.14 |
| IUPAC Name | [3-(benzenesulfonyl)-8-azabicyclo[3.2.1]octan-8-yl]-(3-methylphenyl)methanone |
| SMILES | Cc1cccc(C(=O)N2C3CCC2CC(S(=O)(=O)c2ccccc2)C3)c1 |
| InChI | InChI=1S/C21H23NO3S/c1-15-6-5-7-16(12-15)21(23)22-17-10-11-18(22)14-20(13-17)26(24,25)19-8-3-2-4-9-19/h2-9,12,17-18,20H,10-11,13-14H2,1H3 |
| InChIKey | IADTXWXGFTWZOL-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.49 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |