C24H23NO3S2 — CID 90591444
[3-(benzenesulfonyl)-8-azabicyclo[3.2.1]octan-8-yl]-(4-thiophen-2-ylphenyl)methanone (PubChem CID 90591444) has the molecular formula C24H23NO3S2 and a molecular weight of 437.59 g/mol. Its IUPAC name is [3-(benzenesulfonyl)-8-azabicyclo[3.2.1]octan-8-yl]-(4-thiophen-2-ylphenyl)methanone.
| Compound Name | [3-(benzenesulfonyl)-8-azabicyclo[3.2.1]octan-8-yl]-(4-thiophen-2-ylphenyl)methanone |
|---|---|
| PubChem CID | 90591444 |
| Molecular Formula | C24H23NO3S2 |
| Molecular Weight | 437.59 g/mol |
| Exact Mass | 437.11 |
| IUPAC Name | [3-(benzenesulfonyl)-8-azabicyclo[3.2.1]octan-8-yl]-(4-thiophen-2-ylphenyl)methanone |
| SMILES | O=C(c1ccc(-c2cccs2)cc1)N1C2CCC1CC(S(=O)(=O)c1ccccc1)C2 |
| InChI | InChI=1S/C24H23NO3S2/c26-24(18-10-8-17(9-11-18)23-7-4-14-29-23)25-19-12-13-20(25)16-22(15-19)30(27,28)21-5-2-1-3-6-21/h1-11,14,19-20,22H,12-13,15-16H2 |
| InChIKey | HZMRZDFURYAHRN-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.59 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |