C15H14ClNO4S2 — CID 90595145
1-(benzenesulfonyl)-3-(4-chlorophenyl)sulfonylazetidine (PubChem CID 90595145) has the molecular formula C15H14ClNO4S2 and a molecular weight of 371.87 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-3-(4-chlorophenyl)sulfonylazetidine.
| Compound Name | 1-(benzenesulfonyl)-3-(4-chlorophenyl)sulfonylazetidine |
|---|---|
| PubChem CID | 90595145 |
| Molecular Formula | C15H14ClNO4S2 |
| Molecular Weight | 371.87 g/mol |
| Exact Mass | 371.01 |
| IUPAC Name | 1-(benzenesulfonyl)-3-(4-chlorophenyl)sulfonylazetidine |
| SMILES | O=S(=O)(c1ccc(Cl)cc1)C1CN(S(=O)(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C15H14ClNO4S2/c16-12-6-8-13(9-7-12)22(18,19)15-10-17(11-15)23(20,21)14-4-2-1-3-5-14/h1-9,15H,10-11H2 |
| InChIKey | NNUBYFZVHJYFRH-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.87 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |