C16H15Cl2NO4S2 — CID 90595184
1-[(2-chlorophenyl)methylsulfonyl]-3-(4-chlorophenyl)sulfonylazetidine (PubChem CID 90595184) has the molecular formula C16H15Cl2NO4S2 and a molecular weight of 420.34 g/mol. Its IUPAC name is 1-[(2-chlorophenyl)methylsulfonyl]-3-(4-chlorophenyl)sulfonylazetidine.
| Compound Name | 1-[(2-chlorophenyl)methylsulfonyl]-3-(4-chlorophenyl)sulfonylazetidine |
|---|---|
| PubChem CID | 90595184 |
| Molecular Formula | C16H15Cl2NO4S2 |
| Molecular Weight | 420.34 g/mol |
| Exact Mass | 418.98 |
| IUPAC Name | 1-[(2-chlorophenyl)methylsulfonyl]-3-(4-chlorophenyl)sulfonylazetidine |
| SMILES | O=S(=O)(c1ccc(Cl)cc1)C1CN(S(=O)(=O)Cc2ccccc2Cl)C1 |
| InChI | InChI=1S/C16H15Cl2NO4S2/c17-13-5-7-14(8-6-13)25(22,23)15-9-19(10-15)24(20,21)11-12-3-1-2-4-16(12)18/h1-8,15H,9-11H2 |
| InChIKey | TXSPLJCRYHTUCY-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.34 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |