C13H18ClNO4S2 — CID 90594382
1-(4-chlorophenyl)sulfonyl-3-(2-methylpropylsulfonyl)azetidine (PubChem CID 90594382) has the molecular formula C13H18ClNO4S2 and a molecular weight of 351.88 g/mol. Its IUPAC name is 1-(4-chlorophenyl)sulfonyl-3-(2-methylpropylsulfonyl)azetidine.
| Compound Name | 1-(4-chlorophenyl)sulfonyl-3-(2-methylpropylsulfonyl)azetidine |
|---|---|
| PubChem CID | 90594382 |
| Molecular Formula | C13H18ClNO4S2 |
| Molecular Weight | 351.88 g/mol |
| Exact Mass | 351.04 |
| IUPAC Name | 1-(4-chlorophenyl)sulfonyl-3-(2-methylpropylsulfonyl)azetidine |
| SMILES | CC(C)CS(=O)(=O)C1CN(S(=O)(=O)c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C13H18ClNO4S2/c1-10(2)9-20(16,17)13-7-15(8-13)21(18,19)12-5-3-11(14)4-6-12/h3-6,10,13H,7-9H2,1-2H3 |
| InChIKey | KPEZHEHQSYLQJN-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.88 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |