C16H20ClNO3S — CID 90594222
(E)-3-(4-chlorophenyl)-1-[3-(2-methylpropylsulfonyl)azetidin-1-yl]prop-2-en-1-one (PubChem CID 90594222) has the molecular formula C16H20ClNO3S and a molecular weight of 341.86 g/mol. Its IUPAC name is (E)-3-(4-chlorophenyl)-1-[3-(2-methylpropylsulfonyl)azetidin-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(4-chlorophenyl)-1-[3-(2-methylpropylsulfonyl)azetidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 90594222 |
| Molecular Formula | C16H20ClNO3S |
| Molecular Weight | 341.86 g/mol |
| Exact Mass | 341.09 |
| IUPAC Name | (E)-3-(4-chlorophenyl)-1-[3-(2-methylpropylsulfonyl)azetidin-1-yl]prop-2-en-1-one |
| SMILES | CC(C)CS(=O)(=O)C1CN(C(=O)/C=C/c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C16H20ClNO3S/c1-12(2)11-22(20,21)15-9-18(10-15)16(19)8-5-13-3-6-14(17)7-4-13/h3-8,12,15H,9-11H2,1-2H3/b8-5+ |
| InChIKey | KTPABKOSRSDVSA-VMPITWQZSA-N |
| XLogP | 2.63 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.86 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|