C9H17NO3S — CID 90594084
1-[3-(2-methylpropylsulfonyl)azetidin-1-yl]ethanone (PubChem CID 90594084) has the molecular formula C9H17NO3S and a molecular weight of 219.31 g/mol. Its IUPAC name is 1-[3-(2-methylpropylsulfonyl)azetidin-1-yl]ethanone.
| Compound Name | 1-[3-(2-methylpropylsulfonyl)azetidin-1-yl]ethanone |
|---|---|
| PubChem CID | 90594084 |
| Molecular Formula | C9H17NO3S |
| Molecular Weight | 219.31 g/mol |
| Exact Mass | 219.09 |
| IUPAC Name | 1-[3-(2-methylpropylsulfonyl)azetidin-1-yl]ethanone |
| SMILES | CC(=O)N1CC(S(=O)(=O)CC(C)C)C1 |
| InChI | InChI=1S/C9H17NO3S/c1-7(2)6-14(12,13)9-4-10(5-9)8(3)11/h7,9H,4-6H2,1-3H3 |
| InChIKey | SJTMIMWWYHROGQ-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.31 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |