C13H17F2NO4S2 — CID 90594332
1-(3,4-difluorophenyl)sulfonyl-3-(2-methylpropylsulfonyl)azetidine (PubChem CID 90594332) has the molecular formula C13H17F2NO4S2 and a molecular weight of 353.41 g/mol. Its IUPAC name is 1-(3,4-difluorophenyl)sulfonyl-3-(2-methylpropylsulfonyl)azetidine.
| Compound Name | 1-(3,4-difluorophenyl)sulfonyl-3-(2-methylpropylsulfonyl)azetidine |
|---|---|
| PubChem CID | 90594332 |
| Molecular Formula | C13H17F2NO4S2 |
| Molecular Weight | 353.41 g/mol |
| Exact Mass | 353.06 |
| IUPAC Name | 1-(3,4-difluorophenyl)sulfonyl-3-(2-methylpropylsulfonyl)azetidine |
| SMILES | CC(C)CS(=O)(=O)C1CN(S(=O)(=O)c2ccc(F)c(F)c2)C1 |
| InChI | InChI=1S/C13H17F2NO4S2/c1-9(2)8-21(17,18)11-6-16(7-11)22(19,20)10-3-4-12(14)13(15)5-10/h3-5,9,11H,6-8H2,1-2H3 |
| InChIKey | RHKFMOVLBRAJTF-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.41 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |