C17H24F2N2O3S — CID 26253343
1-(3,4-difluorophenyl)sulfonyl-N-(3-methylbutyl)piperidine-4-carboxamide (PubChem CID 26253343) has the molecular formula C17H24F2N2O3S and a molecular weight of 374.45 g/mol. Its IUPAC name is 1-(3,4-difluorophenyl)sulfonyl-N-(3-methylbutyl)piperidine-4-carboxamide.
| Compound Name | 1-(3,4-difluorophenyl)sulfonyl-N-(3-methylbutyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 26253343 |
| Molecular Formula | C17H24F2N2O3S |
| Molecular Weight | 374.45 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | 1-(3,4-difluorophenyl)sulfonyl-N-(3-methylbutyl)piperidine-4-carboxamide |
| SMILES | CC(C)CCNC(=O)C1CCN(S(=O)(=O)c2ccc(F)c(F)c2)CC1 |
| InChI | InChI=1S/C17H24F2N2O3S/c1-12(2)5-8-20-17(22)13-6-9-21(10-7-13)25(23,24)14-3-4-15(18)16(19)11-14/h3-4,11-13H,5-10H2,1-2H3,(H,20,22) |
| InChIKey | XAJXZBNCDACUHK-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.45 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |