C19H28N2O4S — CID 27556617
1-(4-acetylphenyl)sulfonyl-N-(3-methylbutyl)piperidine-4-carboxamide (PubChem CID 27556617) has the molecular formula C19H28N2O4S and a molecular weight of 380.51 g/mol. Its IUPAC name is 1-(4-acetylphenyl)sulfonyl-N-(3-methylbutyl)piperidine-4-carboxamide.
| Compound Name | 1-(4-acetylphenyl)sulfonyl-N-(3-methylbutyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 27556617 |
| Molecular Formula | C19H28N2O4S |
| Molecular Weight | 380.51 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | 1-(4-acetylphenyl)sulfonyl-N-(3-methylbutyl)piperidine-4-carboxamide |
| SMILES | CC(=O)c1ccc(S(=O)(=O)N2CCC(C(=O)NCCC(C)C)CC2)cc1 |
| InChI | InChI=1S/C19H28N2O4S/c1-14(2)8-11-20-19(23)17-9-12-21(13-10-17)26(24,25)18-6-4-16(5-7-18)15(3)22/h4-7,14,17H,8-13H2,1-3H3,(H,20,23) |
| InChIKey | GVTJHHYRWZJBEP-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.51 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |