C23H36N4O4S — CID 55660055
1-(4-acetylphenyl)sulfonyl-N-[3-(4-ethylpiperazin-1-yl)propyl]piperidine-4-carboxamide (PubChem CID 55660055) has the molecular formula C23H36N4O4S and a molecular weight of 464.63 g/mol. Its IUPAC name is 1-(4-acetylphenyl)sulfonyl-N-[3-(4-ethylpiperazin-1-yl)propyl]piperidine-4-carboxamide.
| Compound Name | 1-(4-acetylphenyl)sulfonyl-N-[3-(4-ethylpiperazin-1-yl)propyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 55660055 |
| Molecular Formula | C23H36N4O4S |
| Molecular Weight | 464.63 g/mol |
| Exact Mass | 464.25 |
| IUPAC Name | 1-(4-acetylphenyl)sulfonyl-N-[3-(4-ethylpiperazin-1-yl)propyl]piperidine-4-carboxamide |
| SMILES | CCN1CCN(CCCNC(=O)C2CCN(S(=O)(=O)c3ccc(C(C)=O)cc3)CC2)CC1 |
| InChI | InChI=1S/C23H36N4O4S/c1-3-25-15-17-26(18-16-25)12-4-11-24-23(29)21-9-13-27(14-10-21)32(30,31)22-7-5-20(6-8-22)19(2)28/h5-8,21H,3-4,9-18H2,1-2H3,(H,24,29) |
| InChIKey | RAJRSMUGQARVJF-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 90.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.63 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|