C24H38N4O5S — CID 55660394
ethyl 4-[4-[3-(4-ethylpiperazin-1-yl)propylcarbamoyl]piperidin-1-yl]sulfonylbenzoate (PubChem CID 55660394) has the molecular formula C24H38N4O5S and a molecular weight of 494.66 g/mol. Its IUPAC name is ethyl 4-[4-[3-(4-ethylpiperazin-1-yl)propylcarbamoyl]piperidin-1-yl]sulfonylbenzoate.
| Compound Name | ethyl 4-[4-[3-(4-ethylpiperazin-1-yl)propylcarbamoyl]piperidin-1-yl]sulfonylbenzoate |
|---|---|
| PubChem CID | 55660394 |
| Molecular Formula | C24H38N4O5S |
| Molecular Weight | 494.66 g/mol |
| Exact Mass | 494.26 |
| IUPAC Name | ethyl 4-[4-[3-(4-ethylpiperazin-1-yl)propylcarbamoyl]piperidin-1-yl]sulfonylbenzoate |
| SMILES | CCOC(=O)c1ccc(S(=O)(=O)N2CCC(C(=O)NCCCN3CCN(CC)CC3)CC2)cc1 |
| InChI | InChI=1S/C24H38N4O5S/c1-3-26-16-18-27(19-17-26)13-5-12-25-23(29)20-10-14-28(15-11-20)34(31,32)22-8-6-21(7-9-22)24(30)33-4-2/h6-9,20H,3-5,10-19H2,1-2H3,(H,25,29) |
| InChIKey | NQXWTEATMLDSRW-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.66 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|