C24H37N3O5S — CID 55848646
ethyl 4-[4-[4-(3-methylbutyl)piperazine-1-carbonyl]piperidin-1-yl]sulfonylbenzoate (PubChem CID 55848646) has the molecular formula C24H37N3O5S and a molecular weight of 479.64 g/mol. Its IUPAC name is ethyl 4-[4-[4-(3-methylbutyl)piperazine-1-carbonyl]piperidin-1-yl]sulfonylbenzoate.
| Compound Name | ethyl 4-[4-[4-(3-methylbutyl)piperazine-1-carbonyl]piperidin-1-yl]sulfonylbenzoate |
|---|---|
| PubChem CID | 55848646 |
| Molecular Formula | C24H37N3O5S |
| Molecular Weight | 479.64 g/mol |
| Exact Mass | 479.25 |
| IUPAC Name | ethyl 4-[4-[4-(3-methylbutyl)piperazine-1-carbonyl]piperidin-1-yl]sulfonylbenzoate |
| SMILES | CCOC(=O)c1ccc(S(=O)(=O)N2CCC(C(=O)N3CCN(CCC(C)C)CC3)CC2)cc1 |
| InChI | InChI=1S/C24H37N3O5S/c1-4-32-24(29)21-5-7-22(8-6-21)33(30,31)27-13-10-20(11-14-27)23(28)26-17-15-25(16-18-26)12-9-19(2)3/h5-8,19-20H,4,9-18H2,1-3H3 |
| InChIKey | VOOOEZZPBBAGQB-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 87.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.64 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |