C23H29N5O5S — CID 42022539
ethyl 4-[4-(4-pyrazin-2-ylpiperazine-1-carbonyl)piperidin-1-yl]sulfonylbenzoate (PubChem CID 42022539) has the molecular formula C23H29N5O5S and a molecular weight of 487.58 g/mol. Its IUPAC name is ethyl 4-[4-(4-pyrazin-2-ylpiperazine-1-carbonyl)piperidin-1-yl]sulfonylbenzoate.
| Compound Name | ethyl 4-[4-(4-pyrazin-2-ylpiperazine-1-carbonyl)piperidin-1-yl]sulfonylbenzoate |
|---|---|
| PubChem CID | 42022539 |
| Molecular Formula | C23H29N5O5S |
| Molecular Weight | 487.58 g/mol |
| Exact Mass | 487.19 |
| IUPAC Name | ethyl 4-[4-(4-pyrazin-2-ylpiperazine-1-carbonyl)piperidin-1-yl]sulfonylbenzoate |
| SMILES | CCOC(=O)c1ccc(S(=O)(=O)N2CCC(C(=O)N3CCN(c4cnccn4)CC3)CC2)cc1 |
| InChI | InChI=1S/C23H29N5O5S/c1-2-33-23(30)19-3-5-20(6-4-19)34(31,32)28-11-7-18(8-12-28)22(29)27-15-13-26(14-16-27)21-17-24-9-10-25-21/h3-6,9-10,17-18H,2,7-8,11-16H2,1H3 |
| InChIKey | SJLWHBHFONRGNF-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 113.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.58 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |