C23H28F2N2O3S — CID 55675373
1-(3,4-difluorophenyl)sulfonyl-N-(3-methyl-2-phenylbutyl)piperidine-4-carboxamide (PubChem CID 55675373) has the molecular formula C23H28F2N2O3S and a molecular weight of 450.55 g/mol. Its IUPAC name is 1-(3,4-difluorophenyl)sulfonyl-N-(3-methyl-2-phenylbutyl)piperidine-4-carboxamide.
| Compound Name | 1-(3,4-difluorophenyl)sulfonyl-N-(3-methyl-2-phenylbutyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 55675373 |
| Molecular Formula | C23H28F2N2O3S |
| Molecular Weight | 450.55 g/mol |
| Exact Mass | 450.18 |
| IUPAC Name | 1-(3,4-difluorophenyl)sulfonyl-N-(3-methyl-2-phenylbutyl)piperidine-4-carboxamide |
| SMILES | CC(C)C(CNC(=O)C1CCN(S(=O)(=O)c2ccc(F)c(F)c2)CC1)c1ccccc1 |
| InChI | InChI=1S/C23H28F2N2O3S/c1-16(2)20(17-6-4-3-5-7-17)15-26-23(28)18-10-12-27(13-11-18)31(29,30)19-8-9-21(24)22(25)14-19/h3-9,14,16,18,20H,10-13,15H2,1-2H3,(H,26,28) |
| InChIKey | XPXKTRWLJILINT-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.55 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |