C24H23F2N3O3S — CID 46554409
N-(4-anilinophenyl)-1-(3,4-difluorophenyl)sulfonylpiperidine-4-carboxamide (PubChem CID 46554409) has the molecular formula C24H23F2N3O3S and a molecular weight of 471.53 g/mol. Its IUPAC name is N-(4-anilinophenyl)-1-(3,4-difluorophenyl)sulfonylpiperidine-4-carboxamide.
| Compound Name | N-(4-anilinophenyl)-1-(3,4-difluorophenyl)sulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 46554409 |
| Molecular Formula | C24H23F2N3O3S |
| Molecular Weight | 471.53 g/mol |
| Exact Mass | 471.14 |
| IUPAC Name | N-(4-anilinophenyl)-1-(3,4-difluorophenyl)sulfonylpiperidine-4-carboxamide |
| SMILES | O=C(Nc1ccc(Nc2ccccc2)cc1)C1CCN(S(=O)(=O)c2ccc(F)c(F)c2)CC1 |
| InChI | InChI=1S/C24H23F2N3O3S/c25-22-11-10-21(16-23(22)26)33(31,32)29-14-12-17(13-15-29)24(30)28-20-8-6-19(7-9-20)27-18-4-2-1-3-5-18/h1-11,16-17,27H,12-15H2,(H,28,30) |
| InChIKey | XGBQVSKTSROPEF-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.53 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |