C18H17Cl2F2N3O3S — CID 16577110
N-(4-amino-3,5-dichlorophenyl)-1-(3,4-difluorophenyl)sulfonylpiperidine-4-carboxamide (PubChem CID 16577110) has the molecular formula C18H17Cl2F2N3O3S and a molecular weight of 464.32 g/mol. Its IUPAC name is N-(4-amino-3,5-dichlorophenyl)-1-(3,4-difluorophenyl)sulfonylpiperidine-4-carboxamide.
| Compound Name | N-(4-amino-3,5-dichlorophenyl)-1-(3,4-difluorophenyl)sulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 16577110 |
| Molecular Formula | C18H17Cl2F2N3O3S |
| Molecular Weight | 464.32 g/mol |
| Exact Mass | 463.03 |
| IUPAC Name | N-(4-amino-3,5-dichlorophenyl)-1-(3,4-difluorophenyl)sulfonylpiperidine-4-carboxamide |
| SMILES | Nc1c(Cl)cc(NC(=O)C2CCN(S(=O)(=O)c3ccc(F)c(F)c3)CC2)cc1Cl |
| InChI | InChI=1S/C18H17Cl2F2N3O3S/c19-13-7-11(8-14(20)17(13)23)24-18(26)10-3-5-25(6-4-10)29(27,28)12-1-2-15(21)16(22)9-12/h1-2,7-10H,3-6,23H2,(H,24,26) |
| InChIKey | CJESFXNENQLMMG-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.32 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|