C16H23F2N3O3S — CID 119499390
N-(3-aminobutyl)-1-(2,5-difluorophenyl)sulfonylpiperidine-4-carboxamide (PubChem CID 119499390) has the molecular formula C16H23F2N3O3S and a molecular weight of 375.44 g/mol. Its IUPAC name is N-(3-aminobutyl)-1-(2,5-difluorophenyl)sulfonylpiperidine-4-carboxamide.
| Compound Name | N-(3-aminobutyl)-1-(2,5-difluorophenyl)sulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 119499390 |
| Molecular Formula | C16H23F2N3O3S |
| Molecular Weight | 375.44 g/mol |
| Exact Mass | 375.14 |
| IUPAC Name | N-(3-aminobutyl)-1-(2,5-difluorophenyl)sulfonylpiperidine-4-carboxamide |
| SMILES | CC(N)CCNC(=O)C1CCN(S(=O)(=O)c2cc(F)ccc2F)CC1 |
| InChI | InChI=1S/C16H23F2N3O3S/c1-11(19)4-7-20-16(22)12-5-8-21(9-6-12)25(23,24)15-10-13(17)2-3-14(15)18/h2-3,10-12H,4-9,19H2,1H3,(H,20,22) |
| InChIKey | INNLBTWMCXSPLV-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.44 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |