C22H25ClF2N2O4S — CID 60578837
N-[3-(4-chloro-2-methylphenoxy)propyl]-1-(2,5-difluorophenyl)sulfonylpiperidine-4-carboxamide (PubChem CID 60578837) has the molecular formula C22H25ClF2N2O4S and a molecular weight of 486.97 g/mol. Its IUPAC name is N-[3-(4-chloro-2-methylphenoxy)propyl]-1-(2,5-difluorophenyl)sulfonylpiperidine-4-carboxamide.
| Compound Name | N-[3-(4-chloro-2-methylphenoxy)propyl]-1-(2,5-difluorophenyl)sulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 60578837 |
| Molecular Formula | C22H25ClF2N2O4S |
| Molecular Weight | 486.97 g/mol |
| Exact Mass | 486.12 |
| IUPAC Name | N-[3-(4-chloro-2-methylphenoxy)propyl]-1-(2,5-difluorophenyl)sulfonylpiperidine-4-carboxamide |
| SMILES | Cc1cc(Cl)ccc1OCCCNC(=O)C1CCN(S(=O)(=O)c2cc(F)ccc2F)CC1 |
| InChI | InChI=1S/C22H25ClF2N2O4S/c1-15-13-17(23)3-6-20(15)31-12-2-9-26-22(28)16-7-10-27(11-8-16)32(29,30)21-14-18(24)4-5-19(21)25/h3-6,13-14,16H,2,7-12H2,1H3,(H,26,28) |
| InChIKey | CNTBKRRIQHYLBR-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.97 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|