C16H25N3O4S — CID 39944100
N-[2-(2,4-dimethylphenoxy)ethyl]-1-sulfamoylpiperidine-4-carboxamide (PubChem CID 39944100) has the molecular formula C16H25N3O4S and a molecular weight of 355.46 g/mol. Its IUPAC name is N-[2-(2,4-dimethylphenoxy)ethyl]-1-sulfamoylpiperidine-4-carboxamide.
| Compound Name | N-[2-(2,4-dimethylphenoxy)ethyl]-1-sulfamoylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 39944100 |
| Molecular Formula | C16H25N3O4S |
| Molecular Weight | 355.46 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | N-[2-(2,4-dimethylphenoxy)ethyl]-1-sulfamoylpiperidine-4-carboxamide |
| SMILES | Cc1ccc(OCCNC(=O)C2CCN(S(N)(=O)=O)CC2)c(C)c1 |
| InChI | InChI=1S/C16H25N3O4S/c1-12-3-4-15(13(2)11-12)23-10-7-18-16(20)14-5-8-19(9-6-14)24(17,21)22/h3-4,11,14H,5-10H2,1-2H3,(H,18,20)(H2,17,21,22) |
| InChIKey | LAZLQZBBDHVCIG-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.46 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|