C18H27N3O5S — CID 32600877
N-[2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]ethyl]-1-sulfamoylpiperidine-4-carboxamide (PubChem CID 32600877) has the molecular formula C18H27N3O5S and a molecular weight of 397.50 g/mol. Its IUPAC name is N-[2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]ethyl]-1-sulfamoylpiperidine-4-carboxamide.
| Compound Name | N-[2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]ethyl]-1-sulfamoylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 32600877 |
| Molecular Formula | C18H27N3O5S |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.17 |
| IUPAC Name | N-[2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]ethyl]-1-sulfamoylpiperidine-4-carboxamide |
| SMILES | CC1(C)Cc2cccc(OCCNC(=O)C3CCN(S(N)(=O)=O)CC3)c2O1 |
| InChI | InChI=1S/C18H27N3O5S/c1-18(2)12-14-4-3-5-15(16(14)26-18)25-11-8-20-17(22)13-6-9-21(10-7-13)27(19,23)24/h3-5,13H,6-12H2,1-2H3,(H,20,22)(H2,19,23,24) |
| InChIKey | KZMAXDNGGVFCQN-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 110.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|