C19H27NO3 — CID 39285980
N-[2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]ethyl]cyclohexanecarboxamide (PubChem CID 39285980) has the molecular formula C19H27NO3 and a molecular weight of 317.43 g/mol. Its IUPAC name is N-[2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]ethyl]cyclohexanecarboxamide.
| Compound Name | N-[2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]ethyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 39285980 |
| Molecular Formula | C19H27NO3 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.20 |
| IUPAC Name | N-[2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]ethyl]cyclohexanecarboxamide |
| SMILES | CC1(C)Cc2cccc(OCCNC(=O)C3CCCCC3)c2O1 |
| InChI | InChI=1S/C19H27NO3/c1-19(2)13-15-9-6-10-16(17(15)23-19)22-12-11-20-18(21)14-7-4-3-5-8-14/h6,9-10,14H,3-5,7-8,11-13H2,1-2H3,(H,20,21) |
| InChIKey | SNPXWTITHQDSPA-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|