C20H26F3NO3 — CID 55791758
N-[2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]ethyl]-2-(trifluoromethyl)cyclohexane-1-carboxamide (PubChem CID 55791758) has the molecular formula C20H26F3NO3 and a molecular weight of 385.43 g/mol. Its IUPAC name is N-[2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]ethyl]-2-(trifluoromethyl)cyclohexane-1-carboxamide.
| Compound Name | N-[2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]ethyl]-2-(trifluoromethyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 55791758 |
| Molecular Formula | C20H26F3NO3 |
| Molecular Weight | 385.43 g/mol |
| Exact Mass | 385.19 |
| IUPAC Name | N-[2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]ethyl]-2-(trifluoromethyl)cyclohexane-1-carboxamide |
| SMILES | CC1(C)Cc2cccc(OCCNC(=O)C3CCCCC3C(F)(F)F)c2O1 |
| InChI | InChI=1S/C20H26F3NO3/c1-19(2)12-13-6-5-9-16(17(13)27-19)26-11-10-24-18(25)14-7-3-4-8-15(14)20(21,22)23/h5-6,9,14-15H,3-4,7-8,10-12H2,1-2H3,(H,24,25) |
| InChIKey | OZMDYYMEVQDESQ-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.43 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|