C22H23NO5 — CID 51938314
(3S)-N-[2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]ethyl]-1-oxo-3,4-dihydroisochromene-3-carboxamide (PubChem CID 51938314) has the molecular formula C22H23NO5 and a molecular weight of 381.43 g/mol. Its IUPAC name is (3S)-N-[2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]ethyl]-1-oxo-3,4-dihydroisochromene-3-carboxamide.
| Compound Name | (3S)-N-[2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]ethyl]-1-oxo-3,4-dihydroisochromene-3-carboxamide |
|---|---|
| PubChem CID | 51938314 |
| Molecular Formula | C22H23NO5 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | (3S)-N-[2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]ethyl]-1-oxo-3,4-dihydroisochromene-3-carboxamide |
| SMILES | CC1(C)Cc2cccc(OCCNC(=O)[C@@H]3Cc4ccccc4C(=O)O3)c2O1 |
| InChI | InChI=1S/C22H23NO5/c1-22(2)13-15-7-5-9-17(19(15)28-22)26-11-10-23-20(24)18-12-14-6-3-4-8-16(14)21(25)27-18/h3-9,18H,10-13H2,1-2H3,(H,23,24)/t18-/m0/s1 |
| InChIKey | VMJZUADPCHPPQN-SFHVURJKSA-N |
| XLogP | 2.68 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|