C22H23NO4 — CID 141497345
2-[4-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]butyl]isoindole-1,3-dione (PubChem CID 141497345) has the molecular formula C22H23NO4 and a molecular weight of 365.43 g/mol. Its IUPAC name is 2-[4-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]butyl]isoindole-1,3-dione.
| Compound Name | 2-[4-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]butyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 141497345 |
| Molecular Formula | C22H23NO4 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | 2-[4-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]butyl]isoindole-1,3-dione |
| SMILES | CC1(C)Cc2cccc(OCCCCN3C(=O)c4ccccc4C3=O)c2O1 |
| InChI | InChI=1S/C22H23NO4/c1-22(2)14-15-8-7-11-18(19(15)27-22)26-13-6-5-12-23-20(24)16-9-3-4-10-17(16)21(23)25/h3-4,7-11H,5-6,12-14H2,1-2H3 |
| InChIKey | AZWWKYWCOZKPQP-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|