C19H17NO5 — CID 70118493
2-[3-(2,3-dihydro-1,4-benzodioxin-5-yloxy)propyl]isoindole-1,3-dione (PubChem CID 70118493) has the molecular formula C19H17NO5 and a molecular weight of 339.35 g/mol. Its IUPAC name is 2-[3-(2,3-dihydro-1,4-benzodioxin-5-yloxy)propyl]isoindole-1,3-dione.
| Compound Name | 2-[3-(2,3-dihydro-1,4-benzodioxin-5-yloxy)propyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 70118493 |
| Molecular Formula | C19H17NO5 |
| Molecular Weight | 339.35 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | 2-[3-(2,3-dihydro-1,4-benzodioxin-5-yloxy)propyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CCCOc1cccc2c1OCCO2 |
| InChI | InChI=1S/C19H17NO5/c21-18-13-5-1-2-6-14(13)19(22)20(18)9-4-10-23-15-7-3-8-16-17(15)25-12-11-24-16/h1-3,5-8H,4,9-12H2 |
| InChIKey | GQSQTTRREYJDMJ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.35 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|