C11H14O6S — CID 87870295
2-(2,3-dihydro-1,4-benzodioxin-5-yloxy)ethyl methanesulfonate (PubChem CID 87870295) has the molecular formula C11H14O6S and a molecular weight of 274.29 g/mol. Its IUPAC name is 2-(2,3-dihydro-1,4-benzodioxin-5-yloxy)ethyl methanesulfonate.
| Compound Name | 2-(2,3-dihydro-1,4-benzodioxin-5-yloxy)ethyl methanesulfonate |
|---|---|
| PubChem CID | 87870295 |
| Molecular Formula | C11H14O6S |
| Molecular Weight | 274.29 g/mol |
| Exact Mass | 274.05 |
| IUPAC Name | 2-(2,3-dihydro-1,4-benzodioxin-5-yloxy)ethyl methanesulfonate |
| SMILES | CS(=O)(=O)OCCOc1cccc2c1OCCO2 |
| InChI | InChI=1S/C11H14O6S/c1-18(12,13)17-8-7-15-10-4-2-3-9-11(10)16-6-5-14-9/h2-4H,5-8H2,1H3 |
| InChIKey | MGXOHSUROPXTDD-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.29 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|