C12H14F2O4 — CID 99827780
5-[2-(2,2-difluoroethoxy)ethoxy]-2,3-dihydro-1,4-benzodioxine (PubChem CID 99827780) has the molecular formula C12H14F2O4 and a molecular weight of 260.24 g/mol. Its IUPAC name is 5-[2-(2,2-difluoroethoxy)ethoxy]-2,3-dihydro-1,4-benzodioxine.
| Compound Name | 5-[2-(2,2-difluoroethoxy)ethoxy]-2,3-dihydro-1,4-benzodioxine |
|---|---|
| PubChem CID | 99827780 |
| Molecular Formula | C12H14F2O4 |
| Molecular Weight | 260.24 g/mol |
| Exact Mass | 260.09 |
| IUPAC Name | 5-[2-(2,2-difluoroethoxy)ethoxy]-2,3-dihydro-1,4-benzodioxine |
| SMILES | FC(F)COCCOc1cccc2c1OCCO2 |
| InChI | InChI=1S/C12H14F2O4/c13-11(14)8-15-4-5-16-9-2-1-3-10-12(9)18-7-6-17-10/h1-3,11H,4-8H2 |
| InChIKey | XHZBFDKHYYFGLP-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.24 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|