C10H10BrF3O2 — CID 167882295
1-bromo-3-[2-(2,2-difluoroethoxy)ethoxy]-2-fluorobenzene (PubChem CID 167882295) has the molecular formula C10H10BrF3O2 and a molecular weight of 299.09 g/mol. Its IUPAC name is 1-bromo-3-[2-(2,2-difluoroethoxy)ethoxy]-2-fluorobenzene.
| Compound Name | 1-bromo-3-[2-(2,2-difluoroethoxy)ethoxy]-2-fluorobenzene |
|---|---|
| PubChem CID | 167882295 |
| Molecular Formula | C10H10BrF3O2 |
| Molecular Weight | 299.09 g/mol |
| Exact Mass | 297.98 |
| IUPAC Name | 1-bromo-3-[2-(2,2-difluoroethoxy)ethoxy]-2-fluorobenzene |
| SMILES | Fc1c(Br)cccc1OCCOCC(F)F |
| InChI | InChI=1S/C10H10BrF3O2/c11-7-2-1-3-8(10(7)14)16-5-4-15-6-9(12)13/h1-3,9H,4-6H2 |
| InChIKey | SHJBYSFNETWVRY-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.09 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|