C13H17N3O2 — CID 61397191
7-(3-azidopropoxy)-2,2-dimethyl-3H-1-benzofuran (PubChem CID 61397191) has the molecular formula C13H17N3O2 and a molecular weight of 247.30 g/mol. Its IUPAC name is 7-(3-azidopropoxy)-2,2-dimethyl-3H-1-benzofuran.
| Compound Name | 7-(3-azidopropoxy)-2,2-dimethyl-3H-1-benzofuran |
|---|---|
| PubChem CID | 61397191 |
| Molecular Formula | C13H17N3O2 |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.13 |
| IUPAC Name | 7-(3-azidopropoxy)-2,2-dimethyl-3H-1-benzofuran |
| SMILES | CC1(C)Cc2cccc(OCCCN=[N+]=[N-])c2O1 |
| InChI | InChI=1S/C13H17N3O2/c1-13(2)9-10-5-3-6-11(12(10)18-13)17-8-4-7-15-16-14/h3,5-6H,4,7-9H2,1-2H3 |
| InChIKey | JYXWYCABNXWMKX-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 67.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|